C20H25N5O — CID 112936163
2-N-[3-(dimethylamino)propyl]-4-N-(furan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112936163) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4-N-(furan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4-N-(furan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112936163 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4-N-(furan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(NCc2ccco2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H25N5O/c1-25(2)12-7-11-21-20-23-18(16-8-4-3-5-9-16)14-19(24-20)22-15-17-10-6-13-26-17/h3-6,8-10,13-14H,7,11-12,15H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | LHGJBGWQVIOBPG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|