C19H29N5 — CID 112936187
2-N-[3-(dimethylamino)propyl]-4-N,4-N-diethyl-6-phenylpyrimidine-2,4-diamine (PubChem CID 112936187) has the molecular formula C19H29N5 and a molecular weight of 327.48 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4-N,4-N-diethyl-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4-N,4-N-diethyl-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112936187 |
| Molecular Formula | C19H29N5 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4-N,4-N-diethyl-6-phenylpyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1cc(-c2ccccc2)nc(NCCCN(C)C)n1 |
| InChI | InChI=1S/C19H29N5/c1-5-24(6-2)18-15-17(16-11-8-7-9-12-16)21-19(22-18)20-13-10-14-23(3)4/h7-9,11-12,15H,5-6,10,13-14H2,1-4H3,(H,20,21,22) |
| InChIKey | BIEIPQMUSLQQNV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|