C18H25N5 — CID 112932935
4-N-cyclopropyl-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine (PubChem CID 112932935) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-N-cyclopropyl-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopropyl-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112932935 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 4-N-cyclopropyl-2-N-[3-(dimethylamino)propyl]-6-phenylpyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(NC2CC2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H25N5/c1-23(2)12-6-11-19-18-21-16(14-7-4-3-5-8-14)13-17(22-18)20-15-9-10-15/h3-5,7-8,13,15H,6,9-12H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | QCCPCPGCKASCPI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|