C20H29N5O — CID 124749031
2-N-[3-(dimethylamino)propyl]-4-N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidine-2,4-diamine (PubChem CID 124749031) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4-N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4-N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 124749031 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4-N-[[(2R)-oxolan-2-yl]methyl]-6-phenylpyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(NC[C@H]2CCCO2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H29N5O/c1-25(2)12-7-11-21-20-23-18(16-8-4-3-5-9-16)14-19(24-20)22-15-17-10-6-13-26-17/h3-5,8-9,14,17H,6-7,10-13,15H2,1-2H3,(H2,21,22,23,24)/t17-/m1/s1 |
| InChIKey | LOMQBLGGFQCHHD-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|