C18H24N4O — CID 112932649
2-N-(oxolan-2-ylmethyl)-6-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine (PubChem CID 112932649) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-N-(oxolan-2-ylmethyl)-6-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(oxolan-2-ylmethyl)-6-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112932649 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-N-(oxolan-2-ylmethyl)-6-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine |
| SMILES | CC(C)Nc1cc(-c2ccccc2)nc(NCC2CCCO2)n1 |
| InChI | InChI=1S/C18H24N4O/c1-13(2)20-17-11-16(14-7-4-3-5-8-14)21-18(22-17)19-12-15-9-6-10-23-15/h3-5,7-8,11,13,15H,6,9-10,12H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | CPHODLQVJUQAOR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |