C22H24N4O — CID 112935698
4-N-benzyl-2-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112935698) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-N-benzyl-2-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112935698 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-N-benzyl-2-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | c1ccc(CNc2cc(-c3ccccc3)nc(NCC3CCCO3)n2)cc1 |
| InChI | InChI=1S/C22H24N4O/c1-3-8-17(9-4-1)15-23-21-14-20(18-10-5-2-6-11-18)25-22(26-21)24-16-19-12-7-13-27-19/h1-6,8-11,14,19H,7,12-13,15-16H2,(H2,23,24,25,26) |
| InChIKey | VRXWIOCZXDTFSJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |