C23H30N4O — CID 112934822
2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine (PubChem CID 112934822) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112934822 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 2-N-[2-(cyclohexen-1-yl)ethyl]-4-N-(oxolan-2-ylmethyl)-6-phenylpyrimidine-2,4-diamine |
| SMILES | C1=C(CCNc2nc(NCC3CCCO3)cc(-c3ccccc3)n2)CCCC1 |
| InChI | InChI=1S/C23H30N4O/c1-3-8-18(9-4-1)13-14-24-23-26-21(19-10-5-2-6-11-19)16-22(27-23)25-17-20-12-7-15-28-20/h2,5-6,8,10-11,16,20H,1,3-4,7,9,12-15,17H2,(H2,24,25,26,27) |
| InChIKey | XBBZLXSDHQKCPK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|