C24H27N5 — CID 112934815
4-N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-N-(pyridin-4-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112934815) has the molecular formula C24H27N5 and a molecular weight of 385.52 g/mol. Its IUPAC name is 4-N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-N-(pyridin-4-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-N-(pyridin-4-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112934815 |
| Molecular Formula | C24H27N5 |
| Molecular Weight | 385.52 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-N-[2-(cyclohexen-1-yl)ethyl]-6-phenyl-2-N-(pyridin-4-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | C1=C(CCNc2cc(-c3ccccc3)nc(NCc3ccncc3)n2)CCCC1 |
| InChI | InChI=1S/C24H27N5/c1-3-7-19(8-4-1)13-16-26-23-17-22(21-9-5-2-6-10-21)28-24(29-23)27-18-20-11-14-25-15-12-20/h2,5-7,9-12,14-15,17H,1,3-4,8,13,16,18H2,(H2,26,27,28,29) |
| InChIKey | APGAJIARBHDWHH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|