C25H25N5 — CID 112937291
6-phenyl-4-N-(3-phenylpropyl)-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112937291) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 6-phenyl-4-N-(3-phenylpropyl)-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 6-phenyl-4-N-(3-phenylpropyl)-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112937291 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 6-phenyl-4-N-(3-phenylpropyl)-2-N-(pyridin-3-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | c1ccc(CCCNc2cc(-c3ccccc3)nc(NCc3cccnc3)n2)cc1 |
| InChI | InChI=1S/C25H25N5/c1-3-9-20(10-4-1)11-8-16-27-24-17-23(22-13-5-2-6-14-22)29-25(30-24)28-19-21-12-7-15-26-18-21/h1-7,9-10,12-15,17-18H,8,11,16,19H2,(H2,27,28,29,30) |
| InChIKey | NBPSVGGSNJVCHW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|