C23H21N5 — CID 112881219
6-N-benzyl-2-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 112881219) has the molecular formula C23H21N5 and a molecular weight of 367.46 g/mol. Its IUPAC name is 6-N-benzyl-2-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-benzyl-2-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112881219 |
| Molecular Formula | C23H21N5 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 6-N-benzyl-2-phenyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | c1ccc(CNc2cc(NCc3cccnc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H21N5/c1-3-8-18(9-4-1)16-25-21-14-22(26-17-19-10-7-13-24-15-19)28-23(27-21)20-11-5-2-6-12-20/h1-15H,16-17H2,(H2,25,26,27,28) |
| InChIKey | UMJMYKVXCLBVAY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |