C20H17N5 — CID 796111
N-benzyl-2-phenyl-6-pyrazol-1-ylpyrimidin-4-amine (PubChem CID 796111) has the molecular formula C20H17N5 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-benzyl-2-phenyl-6-pyrazol-1-ylpyrimidin-4-amine.
| Compound Name | N-benzyl-2-phenyl-6-pyrazol-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 796111 |
| Molecular Formula | C20H17N5 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-benzyl-2-phenyl-6-pyrazol-1-ylpyrimidin-4-amine |
| SMILES | c1ccc(CNc2cc(-n3cccn3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H17N5/c1-3-8-16(9-4-1)15-21-18-14-19(25-13-7-12-22-25)24-20(23-18)17-10-5-2-6-11-17/h1-14H,15H2,(H,21,23,24) |
| InChIKey | HZUYAILRHJSXJH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |