C24H19N5 — CID 112881231
4-[[6-(benzylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112881231) has the molecular formula C24H19N5 and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-[[6-(benzylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[6-(benzylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112881231 |
| Molecular Formula | C24H19N5 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 4-[[6-(benzylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2cc(NCc3ccccc3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H19N5/c25-16-18-11-13-21(14-12-18)27-23-15-22(26-17-19-7-3-1-4-8-19)28-24(29-23)20-9-5-2-6-10-20/h1-15H,17H2,(H2,26,27,28,29) |
| InChIKey | JEDYSFDWUDWTJH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |