C22H17N5O — CID 112881212
3-[[6-(furan-2-ylmethylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112881212) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is 3-[[6-(furan-2-ylmethylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-(furan-2-ylmethylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112881212 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 3-[[6-(furan-2-ylmethylamino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2cc(NCc3ccco3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H17N5O/c23-14-16-6-4-9-18(12-16)25-21-13-20(24-15-19-10-5-11-28-19)26-22(27-21)17-7-2-1-3-8-17/h1-13H,15H2,(H2,24,25,26,27) |
| InChIKey | GWFZNNHONAWGST-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 86.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |