C22H21N5 — CID 112880150
3-[(2-phenyl-6-piperidin-1-ylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 112880150) has the molecular formula C22H21N5 and a molecular weight of 355.45 g/mol. Its IUPAC name is 3-[(2-phenyl-6-piperidin-1-ylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 3-[(2-phenyl-6-piperidin-1-ylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 112880150 |
| Molecular Formula | C22H21N5 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 3-[(2-phenyl-6-piperidin-1-ylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2cc(N3CCCCC3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C22H21N5/c23-16-17-8-7-11-19(14-17)24-20-15-21(27-12-5-2-6-13-27)26-22(25-20)18-9-3-1-4-10-18/h1,3-4,7-11,14-15H,2,5-6,12-13H2,(H,24,25,26) |
| InChIKey | KPKUNRQSHNCNFI-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |