C24H16N6 — CID 112881724
3-[[6-(3-cyanoanilino)-2-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112881724) has the molecular formula C24H16N6 and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-[[6-(3-cyanoanilino)-2-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-(3-cyanoanilino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112881724 |
| Molecular Formula | C24H16N6 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 3-[[6-(3-cyanoanilino)-2-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | N#Cc1cccc(Nc2cc(Nc3cccc(C#N)c3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C24H16N6/c25-15-17-6-4-10-20(12-17)27-22-14-23(28-21-11-5-7-18(13-21)16-26)30-24(29-22)19-8-2-1-3-9-19/h1-14H,(H2,27,28,29,30) |
| InChIKey | XRGAZZONXVCURX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |