C24H19N5 — CID 112938145
3-[[2-(N-methylanilino)-6-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112938145) has the molecular formula C24H19N5 and a molecular weight of 377.45 g/mol. Its IUPAC name is 3-[[2-(N-methylanilino)-6-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[2-(N-methylanilino)-6-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112938145 |
| Molecular Formula | C24H19N5 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3-[[2-(N-methylanilino)-6-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | CN(c1ccccc1)c1nc(Nc2cccc(C#N)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H19N5/c1-29(21-13-6-3-7-14-21)24-27-22(19-10-4-2-5-11-19)16-23(28-24)26-20-12-8-9-18(15-20)17-25/h2-16H,1H3,(H,26,27,28) |
| InChIKey | KQYCGYQZJWLEDG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |