C21H21N5 — CID 124750224
3-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 124750224) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is 3-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 124750224 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 3-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | CC[C@H](C)Nc1nc(Nc2cccc(C#N)c2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H21N5/c1-3-15(2)23-21-25-19(17-9-5-4-6-10-17)13-20(26-21)24-18-11-7-8-16(12-18)14-22/h4-13,15H,3H2,1-2H3,(H2,23,24,25,26)/t15-/m0/s1 |
| InChIKey | VHPHTDMXNGSVQH-HNNXBMFYSA-N |
| XLogP | 4.97 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |