C22H25N5O — CID 124748906
N-[4-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 124748906) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is N-[4-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 124748906 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-[4-[[2-[[(2S)-butan-2-yl]amino]-6-phenylpyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC[C@H](C)Nc1nc(Nc2ccc(NC(C)=O)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H25N5O/c1-4-15(2)23-22-26-20(17-8-6-5-7-9-17)14-21(27-22)25-19-12-10-18(11-13-19)24-16(3)28/h5-15H,4H2,1-3H3,(H,24,28)(H2,23,25,26,27)/t15-/m0/s1 |
| InChIKey | FKXBIRGJLGYALG-HNNXBMFYSA-N |
| XLogP | 5.06 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |