C22H27N5 — CID 112933968
4-N-butan-2-yl-2-N-[4-(dimethylamino)phenyl]-6-phenylpyrimidine-2,4-diamine (PubChem CID 112933968) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-N-butan-2-yl-2-N-[4-(dimethylamino)phenyl]-6-phenylpyrimidine-2,4-diamine.
| Compound Name | 4-N-butan-2-yl-2-N-[4-(dimethylamino)phenyl]-6-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112933968 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-N-butan-2-yl-2-N-[4-(dimethylamino)phenyl]-6-phenylpyrimidine-2,4-diamine |
| SMILES | CCC(C)Nc1cc(-c2ccccc2)nc(Nc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C22H27N5/c1-5-16(2)23-21-15-20(17-9-7-6-8-10-17)25-22(26-21)24-18-11-13-19(14-12-18)27(3)4/h6-16H,5H2,1-4H3,(H2,23,24,25,26) |
| InChIKey | QJHQZWYDHSKMDH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|