C22H23N5 — CID 112938019
4-[[2-[butyl(methyl)amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112938019) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-[[2-[butyl(methyl)amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[2-[butyl(methyl)amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112938019 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 4-[[2-[butyl(methyl)amino]-6-phenylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | CCCCN(C)c1nc(Nc2ccc(C#N)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N5/c1-3-4-14-27(2)22-25-20(18-8-6-5-7-9-18)15-21(26-22)24-19-12-10-17(16-23)11-13-19/h5-13,15H,3-4,14H2,1-2H3,(H,24,25,26) |
| InChIKey | DPXNKGJCBZBCHL-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |