C24H26N4 — CID 156544085
4-[(2-heptan-4-yl-6-phenylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 156544085) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[(2-heptan-4-yl-6-phenylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 4-[(2-heptan-4-yl-6-phenylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 156544085 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-[(2-heptan-4-yl-6-phenylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | CCCC(CCC)c1nc(Nc2ccc(C#N)cc2)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H26N4/c1-3-8-20(9-4-2)24-27-22(19-10-6-5-7-11-19)16-23(28-24)26-21-14-12-18(17-25)13-15-21/h5-7,10-16,20H,3-4,8-9H2,1-2H3,(H,26,27,28) |
| InChIKey | GICLOUZSYSWXCM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |