C17H21N5 — CID 112876232
4-[[2-methyl-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112876232) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-[[2-methyl-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[2-methyl-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112876232 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 4-[[2-methyl-6-(3-methylbutylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1nc(NCCC(C)C)cc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C17H21N5/c1-12(2)8-9-19-16-10-17(21-13(3)20-16)22-15-6-4-14(11-18)5-7-15/h4-7,10,12H,8-9H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | MEWUYTUUWVSBTF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |