C18H14ClN5 — CID 112878011
4-[[6-(3-chloroanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112878011) has the molecular formula C18H14ClN5 and a molecular weight of 335.80 g/mol. Its IUPAC name is 4-[[6-(3-chloroanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 4-[[6-(3-chloroanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112878011 |
| Molecular Formula | C18H14ClN5 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-[[6-(3-chloroanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1nc(Nc2ccc(C#N)cc2)cc(Nc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C18H14ClN5/c1-12-21-17(23-15-7-5-13(11-20)6-8-15)10-18(22-12)24-16-4-2-3-14(19)9-16/h2-10H,1H3,(H2,21,22,23,24) |
| InChIKey | NIDPFDSYKZFMSU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |