C22H23N5 — CID 112877795
3-[[6-(4-tert-butylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112877795) has the molecular formula C22H23N5 and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-[[6-(4-tert-butylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-(4-tert-butylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112877795 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 3-[[6-(4-tert-butylanilino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1nc(Nc2ccc(C(C)(C)C)cc2)cc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C22H23N5/c1-15-24-20(26-18-10-8-17(9-11-18)22(2,3)4)13-21(25-15)27-19-7-5-6-16(12-19)14-23/h5-13H,1-4H3,(H2,24,25,26,27) |
| InChIKey | UFWCQYKDBJSYAC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |