C23H22N4O — CID 109177184
N-(4-tert-butylphenyl)-2-(3-cyanoanilino)pyridine-4-carboxamide (PubChem CID 109177184) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-(3-cyanoanilino)pyridine-4-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-2-(3-cyanoanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109177184 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-(3-cyanoanilino)pyridine-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2ccnc(Nc3cccc(C#N)c3)c2)cc1 |
| InChI | InChI=1S/C23H22N4O/c1-23(2,3)18-7-9-19(10-8-18)27-22(28)17-11-12-25-21(14-17)26-20-6-4-5-16(13-20)15-24/h4-14H,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | AFOVHOASWUMHBT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |