C21H16N4O2 — CID 109178483
N-(3-acetylphenyl)-2-(4-cyanoanilino)pyridine-4-carboxamide (PubChem CID 109178483) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(4-cyanoanilino)pyridine-4-carboxamide.
| Compound Name | N-(3-acetylphenyl)-2-(4-cyanoanilino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109178483 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-(3-acetylphenyl)-2-(4-cyanoanilino)pyridine-4-carboxamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccnc(Nc3ccc(C#N)cc3)c2)c1 |
| InChI | InChI=1S/C21H16N4O2/c1-14(26)16-3-2-4-19(11-16)25-21(27)17-9-10-23-20(12-17)24-18-7-5-15(13-22)6-8-18/h2-12H,1H3,(H,23,24)(H,25,27) |
| InChIKey | BYLLGHBWUATKTI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |