C17H19N5 — CID 112868777
3-[[6-(cyclopentylamino)-2-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112868777) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[[6-(cyclopentylamino)-2-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 3-[[6-(cyclopentylamino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112868777 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[[6-(cyclopentylamino)-2-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1nc(Nc2cccc(C#N)c2)cc(NC2CCCC2)n1 |
| InChI | InChI=1S/C17H19N5/c1-12-19-16(21-14-6-2-3-7-14)10-17(20-12)22-15-8-4-5-13(9-15)11-18/h4-5,8-10,14H,2-3,6-7H2,1H3,(H2,19,20,21,22) |
| InChIKey | VJEQUQNRPWEEBA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |