C15H18N6 — CID 80969827
3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]benzonitrile (PubChem CID 80969827) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]benzonitrile.
| Compound Name | 3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 80969827 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-[(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)amino]benzonitrile |
| SMILES | CC(C)(C)c1nc(NN)cc(Nc2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C15H18N6/c1-15(2,3)14-19-12(8-13(20-14)21-17)18-11-6-4-5-10(7-11)9-16/h4-8H,17H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | OEZHATMLQRYCEY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|