C14H17F2N5 — CID 80969498
2-tert-butyl-N-(2,6-difluorophenyl)-6-hydrazinylpyrimidin-4-amine (PubChem CID 80969498) has the molecular formula C14H17F2N5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 2-tert-butyl-N-(2,6-difluorophenyl)-6-hydrazinylpyrimidin-4-amine.
| Compound Name | 2-tert-butyl-N-(2,6-difluorophenyl)-6-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80969498 |
| Molecular Formula | C14H17F2N5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-tert-butyl-N-(2,6-difluorophenyl)-6-hydrazinylpyrimidin-4-amine |
| SMILES | CC(C)(C)c1nc(NN)cc(Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C14H17F2N5/c1-14(2,3)13-19-10(7-11(20-13)21-17)18-12-8(15)5-4-6-9(12)16/h4-7H,17H2,1-3H3,(H2,18,19,20,21) |
| InChIKey | RGEKFRYNFBJJLZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|