C13H15F2N5 — CID 80946886
N-(2,6-difluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine (PubChem CID 80946886) has the molecular formula C13H15F2N5 and a molecular weight of 279.29 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine.
| Compound Name | N-(2,6-difluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80946886 |
| Molecular Formula | C13H15F2N5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | N-(2,6-difluorophenyl)-6-hydrazinyl-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(NN)cc(Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C13H15F2N5/c1-2-4-10-17-11(7-12(18-10)20-16)19-13-8(14)5-3-6-9(13)15/h3,5-7H,2,4,16H2,1H3,(H2,17,18,19,20) |
| InChIKey | DELZZDAEEDGJIB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|