C7H13N5 — CID 80947336
6-hydrazinyl-2-propylpyrimidin-4-amine (PubChem CID 80947336) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 6-hydrazinyl-2-propylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-2-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80947336 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 6-hydrazinyl-2-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(N)cc(NN)n1 |
| InChI | InChI=1S/C7H13N5/c1-2-3-6-10-5(8)4-7(11-6)12-9/h4H,2-3,9H2,1H3,(H3,8,10,11,12) |
| InChIKey | XNHMQAGQKOUXOT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|