C13H25N5 — CID 80947753
6-hydrazinyl-N,N,2-tripropylpyrimidin-4-amine (PubChem CID 80947753) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is 6-hydrazinyl-N,N,2-tripropylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N,N,2-tripropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80947753 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 6-hydrazinyl-N,N,2-tripropylpyrimidin-4-amine |
| SMILES | CCCc1nc(NN)cc(N(CCC)CCC)n1 |
| InChI | InChI=1S/C13H25N5/c1-4-7-11-15-12(17-14)10-13(16-11)18(8-5-2)9-6-3/h10H,4-9,14H2,1-3H3,(H,15,16,17) |
| InChIKey | QXURDMPPQXHVBI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|