C14H26N4 — CID 80946205
6-N-methyl-4-N,4-N,2-tripropylpyrimidine-4,6-diamine (PubChem CID 80946205) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is 6-N-methyl-4-N,4-N,2-tripropylpyrimidine-4,6-diamine.
| Compound Name | 6-N-methyl-4-N,4-N,2-tripropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 80946205 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | 6-N-methyl-4-N,4-N,2-tripropylpyrimidine-4,6-diamine |
| SMILES | CCCc1nc(NC)cc(N(CCC)CCC)n1 |
| InChI | InChI=1S/C14H26N4/c1-5-8-12-16-13(15-4)11-14(17-12)18(9-6-2)10-7-3/h11H,5-10H2,1-4H3,(H,15,16,17) |
| InChIKey | BNPNOYRJDANGGH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |