C12H16N6 — CID 80946486
2-[cyanomethyl-[6-(methylamino)-2-propylpyrimidin-4-yl]amino]acetonitrile (PubChem CID 80946486) has the molecular formula C12H16N6 and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[cyanomethyl-[6-(methylamino)-2-propylpyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[6-(methylamino)-2-propylpyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 80946486 |
| Molecular Formula | C12H16N6 |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 2-[cyanomethyl-[6-(methylamino)-2-propylpyrimidin-4-yl]amino]acetonitrile |
| SMILES | CCCc1nc(NC)cc(N(CC#N)CC#N)n1 |
| InChI | InChI=1S/C12H16N6/c1-3-4-10-16-11(15-2)9-12(17-10)18(7-5-13)8-6-14/h9H,3-4,7-8H2,1-2H3,(H,15,16,17) |
| InChIKey | RPWWPEWYZSVWCY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|