C9H10N6 — CID 80754040
2-[cyanomethyl-[6-(methylamino)pyrazin-2-yl]amino]acetonitrile (PubChem CID 80754040) has the molecular formula C9H10N6 and a molecular weight of 202.22 g/mol. Its IUPAC name is 2-[cyanomethyl-[6-(methylamino)pyrazin-2-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[6-(methylamino)pyrazin-2-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 80754040 |
| Molecular Formula | C9H10N6 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 2-[cyanomethyl-[6-(methylamino)pyrazin-2-yl]amino]acetonitrile |
| SMILES | CNc1cncc(N(CC#N)CC#N)n1 |
| InChI | InChI=1S/C9H10N6/c1-12-8-6-13-7-9(14-8)15(4-2-10)5-3-11/h6-7H,4-5H2,1H3,(H,12,14) |
| InChIKey | NNJARMHAZVSRKE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 88.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|