About 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine
2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine (PubChem CID 80754126) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine |
| PubChem CID | 80754126 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine |
| SMILES | CNc1cncc(N(Cc2ccccc2)C(C)C)n1 |
| InChI | InChI=1S/C15H20N4/c1-12(2)19(11-13-7-5-4-6-8-13)15-10-17-9-14(16-3)18-15/h4-10,12H,11H2,1-3H3,(H,16,18) |
| InChIKey | VSCRXHVKYTXTHH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine?
The IUPAC name of 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine (CID 80754126) is 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine.
What is the SMILES notation for 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine?
The canonical SMILES for 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine is CNc1cncc(N(Cc2ccccc2)C(C)C)n1.
What is the InChIKey of 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine?
The InChIKey is VSCRXHVKYTXTHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4/c1-12(2)19(11-13-7-5-4-6-8-13)15-10-17-9-14(16-3)18-15/h4-10,12H,11H2,1-3H3,(H,16,18).
What are the key properties of 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine?
2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine has a molecular weight of 256.35 g/mol, XLogP of 2.93, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-benzyl-6-N-methyl-2-N-propan-2-ylpyrazine-2,6-diamine is sourced from PubChem (CID 80754126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).