C19H21N5 — CID 112959376
5-N-benzyl-3-N-phenyl-5-N-propan-2-yl-1,2,4-triazine-3,5-diamine (PubChem CID 112959376) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 5-N-benzyl-3-N-phenyl-5-N-propan-2-yl-1,2,4-triazine-3,5-diamine.
| Compound Name | 5-N-benzyl-3-N-phenyl-5-N-propan-2-yl-1,2,4-triazine-3,5-diamine |
|---|---|
| PubChem CID | 112959376 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 5-N-benzyl-3-N-phenyl-5-N-propan-2-yl-1,2,4-triazine-3,5-diamine |
| SMILES | CC(C)N(Cc1ccccc1)c1cnnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C19H21N5/c1-15(2)24(14-16-9-5-3-6-10-16)18-13-20-23-19(22-18)21-17-11-7-4-8-12-17/h3-13,15H,14H2,1-2H3,(H,21,22,23) |
| InChIKey | GJPOHUGTLHXXMK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |