C20H22N4 — CID 112900009
4-N-benzyl-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine (PubChem CID 112900009) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-N-benzyl-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112900009 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-N-benzyl-2-N-phenyl-4-N-propan-2-ylpyrimidine-2,4-diamine |
| SMILES | CC(C)N(Cc1ccccc1)c1ccnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H22N4/c1-16(2)24(15-17-9-5-3-6-10-17)19-13-14-21-20(23-19)22-18-11-7-4-8-12-18/h3-14,16H,15H2,1-2H3,(H,21,22,23) |
| InChIKey | PXZKNMBOOFVCJC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |