C17H22N4 — CID 112882729
4-N-benzyl-4-N-propan-2-yl-2-N-prop-2-enylpyrimidine-2,4-diamine (PubChem CID 112882729) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-N-benzyl-4-N-propan-2-yl-2-N-prop-2-enylpyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-4-N-propan-2-yl-2-N-prop-2-enylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112882729 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-N-benzyl-4-N-propan-2-yl-2-N-prop-2-enylpyrimidine-2,4-diamine |
| SMILES | C=CCNc1nccc(N(Cc2ccccc2)C(C)C)n1 |
| InChI | InChI=1S/C17H22N4/c1-4-11-18-17-19-12-10-16(20-17)21(14(2)3)13-15-8-6-5-7-9-15/h4-10,12,14H,1,11,13H2,2-3H3,(H,18,19,20) |
| InChIKey | XFMDULZKKCTBRT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|