C9H18N6 — CID 80944737
4-N-ethyl-6-hydrazinyl-4-N-propylpyrimidine-2,4-diamine (PubChem CID 80944737) has the molecular formula C9H18N6 and a molecular weight of 210.28 g/mol. Its IUPAC name is 4-N-ethyl-6-hydrazinyl-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-6-hydrazinyl-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80944737 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 4-N-ethyl-6-hydrazinyl-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCN(CC)c1cc(NN)nc(N)n1 |
| InChI | InChI=1S/C9H18N6/c1-3-5-15(4-2)8-6-7(14-11)12-9(10)13-8/h6H,3-5,11H2,1-2H3,(H3,10,12,13,14) |
| InChIKey | ANXBIOCXUDKHQJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|