C13H26N6 — CID 102999011
N'-ethyl-N'-(2-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethylpropane-1,3-diamine (PubChem CID 102999011) has the molecular formula C13H26N6 and a molecular weight of 266.39 g/mol. Its IUPAC name is N'-ethyl-N'-(2-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-ethyl-N'-(2-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102999011 |
| Molecular Formula | C13H26N6 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | N'-ethyl-N'-(2-ethyl-6-hydrazinylpyrimidin-4-yl)-N,N-dimethylpropane-1,3-diamine |
| SMILES | CCc1nc(NN)cc(N(CC)CCCN(C)C)n1 |
| InChI | InChI=1S/C13H26N6/c1-5-11-15-12(17-14)10-13(16-11)19(6-2)9-7-8-18(3)4/h10H,5-9,14H2,1-4H3,(H,15,16,17) |
| InChIKey | URZTWYBRFVPOQK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|