C15H21N5 — CID 80936913
2-ethyl-N-(4-ethylphenyl)-6-hydrazinyl-N-methylpyrimidin-4-amine (PubChem CID 80936913) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 2-ethyl-N-(4-ethylphenyl)-6-hydrazinyl-N-methylpyrimidin-4-amine.
| Compound Name | 2-ethyl-N-(4-ethylphenyl)-6-hydrazinyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80936913 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 2-ethyl-N-(4-ethylphenyl)-6-hydrazinyl-N-methylpyrimidin-4-amine |
| SMILES | CCc1ccc(N(C)c2cc(NN)nc(CC)n2)cc1 |
| InChI | InChI=1S/C15H21N5/c1-4-11-6-8-12(9-7-11)20(3)15-10-14(19-16)17-13(5-2)18-15/h6-10H,4-5,16H2,1-3H3,(H,17,18,19) |
| InChIKey | ARDQPPKZGWMZQV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|