C10H19N5 — CID 80932802
6-hydrazinyl-N,N-dipropylpyrimidin-4-amine (PubChem CID 80932802) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 6-hydrazinyl-N,N-dipropylpyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N,N-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80932802 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 6-hydrazinyl-N,N-dipropylpyrimidin-4-amine |
| SMILES | CCCN(CCC)c1cc(NN)ncn1 |
| InChI | InChI=1S/C10H19N5/c1-3-5-15(6-4-2)10-7-9(14-11)12-8-13-10/h7-8H,3-6,11H2,1-2H3,(H,12,13,14) |
| InChIKey | CKCFHZKDYKUQDT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|