C16H19F3N4 — CID 112864554
4-N,4-N-dipropyl-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 112864554) has the molecular formula C16H19F3N4 and a molecular weight of 324.35 g/mol. Its IUPAC name is 4-N,4-N-dipropyl-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dipropyl-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864554 |
| Molecular Formula | C16H19F3N4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-N,4-N-dipropyl-6-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | CCCN(CCC)c1cc(Nc2ccc(F)c(F)c2F)ncn1 |
| InChI | InChI=1S/C16H19F3N4/c1-3-7-23(8-4-2)14-9-13(20-10-21-14)22-12-6-5-11(17)15(18)16(12)19/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,20,21,22) |
| InChIKey | BAFHODYWDWGOKG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|