C15H19FN4 — CID 112864218
4-N-butyl-6-N-(2-fluorophenyl)-4-N-methylpyrimidine-4,6-diamine (PubChem CID 112864218) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-N-butyl-6-N-(2-fluorophenyl)-4-N-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-butyl-6-N-(2-fluorophenyl)-4-N-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864218 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 4-N-butyl-6-N-(2-fluorophenyl)-4-N-methylpyrimidine-4,6-diamine |
| SMILES | CCCCN(C)c1cc(Nc2ccccc2F)ncn1 |
| InChI | InChI=1S/C15H19FN4/c1-3-4-9-20(2)15-10-14(17-11-18-15)19-13-8-6-5-7-12(13)16/h5-8,10-11H,3-4,9H2,1-2H3,(H,17,18,19) |
| InChIKey | BHPNDGCJHPLEJM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |