C11H17N5 — CID 115264736
[6-[methyl(pentyl)amino]pyrimidin-4-yl]cyanamide (PubChem CID 115264736) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is [6-[methyl(pentyl)amino]pyrimidin-4-yl]cyanamide.
| Compound Name | [6-[methyl(pentyl)amino]pyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 115264736 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | [6-[methyl(pentyl)amino]pyrimidin-4-yl]cyanamide |
| SMILES | CCCCCN(C)c1cc(NC#N)ncn1 |
| InChI | InChI=1S/C11H17N5/c1-3-4-5-6-16(2)11-7-10(13-8-12)14-9-15-11/h7,9H,3-6H2,1-2H3,(H,13,14,15) |
| InChIKey | BHSBWJZVQHDNDZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|