C18H20F3N3O — CID 109175957
2-(dipropylamino)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide (PubChem CID 109175957) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is 2-(dipropylamino)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide.
| Compound Name | 2-(dipropylamino)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 109175957 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 2-(dipropylamino)-N-(2,3,4-trifluorophenyl)pyridine-4-carboxamide |
| SMILES | CCCN(CCC)c1cc(C(=O)Nc2ccc(F)c(F)c2F)ccn1 |
| InChI | InChI=1S/C18H20F3N3O/c1-3-9-24(10-4-2)15-11-12(7-8-22-15)18(25)23-14-6-5-13(19)16(20)17(14)21/h5-8,11H,3-4,9-10H2,1-2H3,(H,23,25) |
| InChIKey | KFAYBASAYJFQCI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|