C18H25ClN4 — CID 112862527
6-N-[2-(4-chlorophenyl)ethyl]-4-N,4-N-dipropylpyrimidine-4,6-diamine (PubChem CID 112862527) has the molecular formula C18H25ClN4 and a molecular weight of 332.88 g/mol. Its IUPAC name is 6-N-[2-(4-chlorophenyl)ethyl]-4-N,4-N-dipropylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[2-(4-chlorophenyl)ethyl]-4-N,4-N-dipropylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112862527 |
| Molecular Formula | C18H25ClN4 |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 6-N-[2-(4-chlorophenyl)ethyl]-4-N,4-N-dipropylpyrimidine-4,6-diamine |
| SMILES | CCCN(CCC)c1cc(NCCc2ccc(Cl)cc2)ncn1 |
| InChI | InChI=1S/C18H25ClN4/c1-3-11-23(12-4-2)18-13-17(21-14-22-18)20-10-9-15-5-7-16(19)8-6-15/h5-8,13-14H,3-4,9-12H2,1-2H3,(H,20,21,22) |
| InChIKey | HBRHREPTYQLCFT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |