C17H24N4 — CID 112863444
4-N,4-N-diethyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine (PubChem CID 112863444) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 4-N,4-N-diethyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-diethyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112863444 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 4-N,4-N-diethyl-6-N-(3-phenylpropyl)pyrimidine-4,6-diamine |
| SMILES | CCN(CC)c1cc(NCCCc2ccccc2)ncn1 |
| InChI | InChI=1S/C17H24N4/c1-3-21(4-2)17-13-16(19-14-20-17)18-12-8-11-15-9-6-5-7-10-15/h5-7,9-10,13-14H,3-4,8,11-12H2,1-2H3,(H,18,19,20) |
| InChIKey | KDHHGNJZTMYJRZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|