C19H21N5 — CID 112860904
6-N-(3-phenylpropyl)-4-N-(pyridin-4-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 112860904) has the molecular formula C19H21N5 and a molecular weight of 319.41 g/mol. Its IUPAC name is 6-N-(3-phenylpropyl)-4-N-(pyridin-4-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-phenylpropyl)-4-N-(pyridin-4-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112860904 |
| Molecular Formula | C19H21N5 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 6-N-(3-phenylpropyl)-4-N-(pyridin-4-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | c1ccc(CCCNc2cc(NCc3ccncc3)ncn2)cc1 |
| InChI | InChI=1S/C19H21N5/c1-2-5-16(6-3-1)7-4-10-21-18-13-19(24-15-23-18)22-14-17-8-11-20-12-9-17/h1-3,5-6,8-9,11-13,15H,4,7,10,14H2,(H2,21,22,23,24) |
| InChIKey | IQNLYGGTCDNWCW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|